C15H15BrClNO2S — CID 102831512
propyl 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]benzoate (PubChem CID 102831512) has the molecular formula C15H15BrClNO2S and a molecular weight of 388.71 g/mol. Its IUPAC name is propyl 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]benzoate.
| Compound Name | propyl 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 102831512 |
| Molecular Formula | C15H15BrClNO2S |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | propyl 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NCc2cc(Br)c(Cl)s2)cc1 |
| InChI | InChI=1S/C15H15BrClNO2S/c1-2-7-20-15(19)10-3-5-11(6-4-10)18-9-12-8-13(16)14(17)21-12/h3-6,8,18H,2,7,9H2,1H3 |
| InChIKey | WPXDWOMEMGRUKD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |