C12H9BrClFN2OS — CID 102832679
5-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-2-fluorobenzamide (PubChem CID 102832679) has the molecular formula C12H9BrClFN2OS and a molecular weight of 363.64 g/mol. Its IUPAC name is 5-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-2-fluorobenzamide.
| Compound Name | 5-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 102832679 |
| Molecular Formula | C12H9BrClFN2OS |
| Molecular Weight | 363.64 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 5-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(NCc2cc(Br)c(Cl)s2)ccc1F |
| InChI | InChI=1S/C12H9BrClFN2OS/c13-9-4-7(19-11(9)14)5-17-6-1-2-10(15)8(3-6)12(16)18/h1-4,17H,5H2,(H2,16,18) |
| InChIKey | IZHSYYKJOWPBOO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |