C15H16Br2N2OS — CID 102831885
3-[(4,5-dibromothiophen-2-yl)methylamino]-N-propylbenzamide (PubChem CID 102831885) has the molecular formula C15H16Br2N2OS and a molecular weight of 432.18 g/mol. Its IUPAC name is 3-[(4,5-dibromothiophen-2-yl)methylamino]-N-propylbenzamide.
| Compound Name | 3-[(4,5-dibromothiophen-2-yl)methylamino]-N-propylbenzamide |
|---|---|
| PubChem CID | 102831885 |
| Molecular Formula | C15H16Br2N2OS |
| Molecular Weight | 432.18 g/mol |
| Exact Mass | 429.94 |
| IUPAC Name | 3-[(4,5-dibromothiophen-2-yl)methylamino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cccc(NCc2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C15H16Br2N2OS/c1-2-6-18-15(20)10-4-3-5-11(7-10)19-9-12-8-13(16)14(17)21-12/h3-5,7-8,19H,2,6,9H2,1H3,(H,18,20) |
| InChIKey | MOCDUMDQWIMLNL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.18 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |