C13H12N4S — CID 55109620
3-pyrazol-1-yl-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 55109620) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-pyrazol-1-yl-N-(1,3-thiazol-5-ylmethyl)aniline.
| Compound Name | 3-pyrazol-1-yl-N-(1,3-thiazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 55109620 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-pyrazol-1-yl-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | c1cc(NCc2cncs2)cc(-n2cccn2)c1 |
| InChI | InChI=1S/C13H12N4S/c1-3-11(15-9-13-8-14-10-18-13)7-12(4-1)17-6-2-5-16-17/h1-8,10,15H,9H2 |
| InChIKey | XNXNBPJTUVHVIS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |