C14H15Br2NO3S — CID 102830159
N-[(4,5-dibromothiophen-2-yl)methyl]-3,4,5-trimethoxyaniline (PubChem CID 102830159) has the molecular formula C14H15Br2NO3S and a molecular weight of 437.15 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-3,4,5-trimethoxyaniline.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3,4,5-trimethoxyaniline |
|---|---|
| PubChem CID | 102830159 |
| Molecular Formula | C14H15Br2NO3S |
| Molecular Weight | 437.15 g/mol |
| Exact Mass | 434.91 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3,4,5-trimethoxyaniline |
| SMILES | COc1cc(NCc2cc(Br)c(Br)s2)cc(OC)c1OC |
| InChI | InChI=1S/C14H15Br2NO3S/c1-18-11-4-8(5-12(19-2)13(11)20-3)17-7-9-6-10(15)14(16)21-9/h4-6,17H,7H2,1-3H3 |
| InChIKey | NKZLFTRTECOZBR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.15 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|