C17H25NO2S — CID 142222422
3,4-dimethoxy-5-methyl-N-[(5-methylthiophen-2-yl)methyl]aniline;ethane (PubChem CID 142222422) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is 3,4-dimethoxy-5-methyl-N-[(5-methylthiophen-2-yl)methyl]aniline;ethane.
| Compound Name | 3,4-dimethoxy-5-methyl-N-[(5-methylthiophen-2-yl)methyl]aniline;ethane |
|---|---|
| PubChem CID | 142222422 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 3,4-dimethoxy-5-methyl-N-[(5-methylthiophen-2-yl)methyl]aniline;ethane |
| SMILES | CC.COc1cc(NCc2ccc(C)s2)cc(C)c1OC |
| InChI | InChI=1S/C15H19NO2S.C2H6/c1-10-7-12(8-14(17-3)15(10)18-4)16-9-13-6-5-11(2)19-13;1-2/h5-8,16H,9H2,1-4H3;1-2H3 |
| InChIKey | PIQFLXVDQJSHLC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|