C13H13Br2NS — CID 102830609
N-[(4,5-dibromothiophen-2-yl)methyl]-2-ethylaniline (PubChem CID 102830609) has the molecular formula C13H13Br2NS and a molecular weight of 375.13 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-2-ethylaniline.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-2-ethylaniline |
|---|---|
| PubChem CID | 102830609 |
| Molecular Formula | C13H13Br2NS |
| Molecular Weight | 375.13 g/mol |
| Exact Mass | 372.91 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-2-ethylaniline |
| SMILES | CCc1ccccc1NCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H13Br2NS/c1-2-9-5-3-4-6-12(9)16-8-10-7-11(14)13(15)17-10/h3-7,16H,2,8H2,1H3 |
| InChIKey | CBVVDWGSCGYKAB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.13 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |