C15H12Br2N2S — CID 102835610
N-[(4,5-dibromothiophen-2-yl)methyl]-2-methylquinolin-8-amine (PubChem CID 102835610) has the molecular formula C15H12Br2N2S and a molecular weight of 412.15 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-2-methylquinolin-8-amine.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-2-methylquinolin-8-amine |
|---|---|
| PubChem CID | 102835610 |
| Molecular Formula | C15H12Br2N2S |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-2-methylquinolin-8-amine |
| SMILES | Cc1ccc2cccc(NCc3cc(Br)c(Br)s3)c2n1 |
| InChI | InChI=1S/C15H12Br2N2S/c1-9-5-6-10-3-2-4-13(14(10)19-9)18-8-11-7-12(16)15(17)20-11/h2-7,18H,8H2,1H3 |
| InChIKey | OGRGIHIFMYEILH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |