C12H10Br2INS — CID 114256939
N-[(4,5-dibromothiophen-2-yl)methyl]-3-iodo-2-methylaniline (PubChem CID 114256939) has the molecular formula C12H10Br2INS and a molecular weight of 487.00 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-3-iodo-2-methylaniline.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-iodo-2-methylaniline |
|---|---|
| PubChem CID | 114256939 |
| Molecular Formula | C12H10Br2INS |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 484.79 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-iodo-2-methylaniline |
| SMILES | Cc1c(I)cccc1NCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H10Br2INS/c1-7-10(15)3-2-4-11(7)16-6-8-5-9(13)12(14)17-8/h2-5,16H,6H2,1H3 |
| InChIKey | VFMNXCZENXASMJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|