C15H24N2O3S — CID 43743918
3-[(2,6-dimethylcyclohexyl)amino]-4-methoxybenzenesulfonamide (PubChem CID 43743918) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-[(2,6-dimethylcyclohexyl)amino]-4-methoxybenzenesulfonamide.
| Compound Name | 3-[(2,6-dimethylcyclohexyl)amino]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 43743918 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-[(2,6-dimethylcyclohexyl)amino]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NC1C(C)CCCC1C |
| InChI | InChI=1S/C15H24N2O3S/c1-10-5-4-6-11(2)15(10)17-13-9-12(21(16,18)19)7-8-14(13)20-3/h7-11,15,17H,4-6H2,1-3H3,(H2,16,18,19) |
| InChIKey | WFZDXEPGRWTVJD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |