C15H24N2O3S — CID 65080223
4-methoxy-3-[(4-methylcycloheptyl)amino]benzenesulfonamide (PubChem CID 65080223) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-methoxy-3-[(4-methylcycloheptyl)amino]benzenesulfonamide.
| Compound Name | 4-methoxy-3-[(4-methylcycloheptyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 65080223 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-methoxy-3-[(4-methylcycloheptyl)amino]benzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NC1CCCC(C)CC1 |
| InChI | InChI=1S/C15H24N2O3S/c1-11-4-3-5-12(7-6-11)17-14-10-13(21(16,18)19)8-9-15(14)20-2/h8-12,17H,3-7H2,1-2H3,(H2,16,18,19) |
| InChIKey | ZIMZMCDUMBKARP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |