C16H23NO3 — CID 63743628
3-[(2,6-dimethylcyclohexyl)amino]-4-methoxybenzoic acid (PubChem CID 63743628) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-[(2,6-dimethylcyclohexyl)amino]-4-methoxybenzoic acid.
| Compound Name | 3-[(2,6-dimethylcyclohexyl)amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 63743628 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-[(2,6-dimethylcyclohexyl)amino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC1C(C)CCCC1C |
| InChI | InChI=1S/C16H23NO3/c1-10-5-4-6-11(2)15(10)17-13-9-12(16(18)19)7-8-14(13)20-3/h7-11,15,17H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | GSUISCUNOGAARF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |