C16H24ClNO2 — CID 43712363
2-chloro-N-(2,6-dimethylcyclohexyl)-4,5-dimethoxyaniline (PubChem CID 43712363) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dimethylcyclohexyl)-4,5-dimethoxyaniline.
| Compound Name | 2-chloro-N-(2,6-dimethylcyclohexyl)-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 43712363 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-chloro-N-(2,6-dimethylcyclohexyl)-4,5-dimethoxyaniline |
| SMILES | COc1cc(Cl)c(NC2C(C)CCCC2C)cc1OC |
| InChI | InChI=1S/C16H24ClNO2/c1-10-6-5-7-11(2)16(10)18-13-9-15(20-4)14(19-3)8-12(13)17/h8-11,16,18H,5-7H2,1-4H3 |
| InChIKey | OJBWEEPOSWSDSZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|