C14H21ClN2O2 — CID 81466523
N-(2-chloro-4,5-dimethoxyphenyl)-1,5-dimethylpyrrolidin-3-amine (PubChem CID 81466523) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-1,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-1,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81466523 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-1,5-dimethylpyrrolidin-3-amine |
| SMILES | COc1cc(Cl)c(NC2CC(C)N(C)C2)cc1OC |
| InChI | InChI=1S/C14H21ClN2O2/c1-9-5-10(8-17(9)2)16-12-7-14(19-4)13(18-3)6-11(12)15/h6-7,9-10,16H,5,8H2,1-4H3 |
| InChIKey | HLLKZPXAGNPQGR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|