C13H16ClN3 — CID 114003381
3-chloro-4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzonitrile (PubChem CID 114003381) has the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. Its IUPAC name is 3-chloro-4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzonitrile.
| Compound Name | 3-chloro-4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 114003381 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-chloro-4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzonitrile |
| SMILES | CC1CC(Nc2ccc(C#N)cc2Cl)CN1C |
| InChI | InChI=1S/C13H16ClN3/c1-9-5-11(8-17(9)2)16-13-4-3-10(7-15)6-12(13)14/h3-4,6,9,11,16H,5,8H2,1-2H3 |
| InChIKey | NSOWTUNKZYADTH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |