C15H19ClN2 — CID 107807300
3-chloro-4-[(4-methylcycloheptyl)amino]benzonitrile (PubChem CID 107807300) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 3-chloro-4-[(4-methylcycloheptyl)amino]benzonitrile.
| Compound Name | 3-chloro-4-[(4-methylcycloheptyl)amino]benzonitrile |
|---|---|
| PubChem CID | 107807300 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-chloro-4-[(4-methylcycloheptyl)amino]benzonitrile |
| SMILES | CC1CCCC(Nc2ccc(C#N)cc2Cl)CC1 |
| InChI | InChI=1S/C15H19ClN2/c1-11-3-2-4-13(7-5-11)18-15-8-6-12(10-17)9-14(15)16/h6,8-9,11,13,18H,2-5,7H2,1H3 |
| InChIKey | WBDDVDXIKZDIHX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |