C18H25ClN2 — CID 107807566
4-[(4-tert-butylcycloheptyl)amino]-3-chlorobenzonitrile (PubChem CID 107807566) has the molecular formula C18H25ClN2 and a molecular weight of 304.87 g/mol. Its IUPAC name is 4-[(4-tert-butylcycloheptyl)amino]-3-chlorobenzonitrile.
| Compound Name | 4-[(4-tert-butylcycloheptyl)amino]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 107807566 |
| Molecular Formula | C18H25ClN2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4-[(4-tert-butylcycloheptyl)amino]-3-chlorobenzonitrile |
| SMILES | CC(C)(C)C1CCCC(Nc2ccc(C#N)cc2Cl)CC1 |
| InChI | InChI=1S/C18H25ClN2/c1-18(2,3)14-5-4-6-15(9-8-14)21-17-10-7-13(12-20)11-16(17)19/h7,10-11,14-15,21H,4-6,8-9H2,1-3H3 |
| InChIKey | ZTEKXGZKLQUOMJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |