C18H25ClN2 — CID 107807374
4-[(4-tert-butylcyclohexyl)methylamino]-3-chlorobenzonitrile (PubChem CID 107807374) has the molecular formula C18H25ClN2 and a molecular weight of 304.87 g/mol. Its IUPAC name is 4-[(4-tert-butylcyclohexyl)methylamino]-3-chlorobenzonitrile.
| Compound Name | 4-[(4-tert-butylcyclohexyl)methylamino]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 107807374 |
| Molecular Formula | C18H25ClN2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4-[(4-tert-butylcyclohexyl)methylamino]-3-chlorobenzonitrile |
| SMILES | CC(C)(C)C1CCC(CNc2ccc(C#N)cc2Cl)CC1 |
| InChI | InChI=1S/C18H25ClN2/c1-18(2,3)15-7-4-13(5-8-15)12-21-17-9-6-14(11-20)10-16(17)19/h6,9-10,13,15,21H,4-5,7-8,12H2,1-3H3 |
| InChIKey | CSSSUWRUTPGVAV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |