C14H17ClN2O — CID 114147400
3-chloro-4-[(3-hydroxycyclohexyl)methylamino]benzonitrile (PubChem CID 114147400) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 3-chloro-4-[(3-hydroxycyclohexyl)methylamino]benzonitrile.
| Compound Name | 3-chloro-4-[(3-hydroxycyclohexyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 114147400 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-chloro-4-[(3-hydroxycyclohexyl)methylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCC2CCCC(O)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2O/c15-13-7-10(8-16)4-5-14(13)17-9-11-2-1-3-12(18)6-11/h4-5,7,11-12,17-18H,1-3,6,9H2 |
| InChIKey | BOBPZEGBUOBPBB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |