C11H19N3O4S — CID 114814135
2-methoxy-5-[(2-methoxyethylsulfamoylamino)methyl]aniline (PubChem CID 114814135) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-methoxy-5-[(2-methoxyethylsulfamoylamino)methyl]aniline.
| Compound Name | 2-methoxy-5-[(2-methoxyethylsulfamoylamino)methyl]aniline |
|---|---|
| PubChem CID | 114814135 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-methoxy-5-[(2-methoxyethylsulfamoylamino)methyl]aniline |
| SMILES | COCCNS(=O)(=O)NCc1ccc(OC)c(N)c1 |
| InChI | InChI=1S/C11H19N3O4S/c1-17-6-5-13-19(15,16)14-8-9-3-4-11(18-2)10(12)7-9/h3-4,7,13-14H,5-6,8,12H2,1-2H3 |
| InChIKey | RHMGUQJHWVLCBN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|