C14H16FN3OS — CID 81407925
3-fluoro-N'-hydroxy-4-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]benzenecarboximidamide (PubChem CID 81407925) has the molecular formula C14H16FN3OS and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 81407925 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]benzenecarboximidamide |
| SMILES | C[C@H](NCc1ccc(/C(N)=N/O)cc1F)c1cccs1 |
| InChI | InChI=1S/C14H16FN3OS/c1-9(13-3-2-6-20-13)17-8-11-5-4-10(7-12(11)15)14(16)18-19/h2-7,9,17,19H,8H2,1H3,(H2,16,18)/t9-/m0/s1 |
| InChIKey | RDRLZOLQYVVSGW-VIFPVBQESA-N |
| XLogP | 2.83 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|