C14H12F3NO2S — CID 3761631
1-phenyl-N-[(3,4,5-trifluorophenyl)methyl]methanesulfonamide (PubChem CID 3761631) has the molecular formula C14H12F3NO2S and a molecular weight of 315.32 g/mol. Its IUPAC name is 1-phenyl-N-[(3,4,5-trifluorophenyl)methyl]methanesulfonamide.
| Compound Name | 1-phenyl-N-[(3,4,5-trifluorophenyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 3761631 |
| Molecular Formula | C14H12F3NO2S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 1-phenyl-N-[(3,4,5-trifluorophenyl)methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H12F3NO2S/c15-12-6-11(7-13(16)14(12)17)8-18-21(19,20)9-10-4-2-1-3-5-10/h1-7,18H,8-9H2 |
| InChIKey | BUSFOLKWHWSLLA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|