C13H8F5NO2S — CID 17374357
N-(2,3,4,5,6-pentafluorophenyl)-1-phenylmethanesulfonamide (PubChem CID 17374357) has the molecular formula C13H8F5NO2S and a molecular weight of 337.27 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)-1-phenylmethanesulfonamide.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 17374357 |
| Molecular Formula | C13H8F5NO2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H8F5NO2S/c14-8-9(15)11(17)13(12(18)10(8)16)19-22(20,21)6-7-4-2-1-3-5-7/h1-5,19H,6H2 |
| InChIKey | QHQXJFGEWLNGQA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|