C13H11F2NO3S — CID 69009630
N-(3,4-difluoro-2-hydroxyphenyl)-1-phenylmethanesulfonamide (PubChem CID 69009630) has the molecular formula C13H11F2NO3S and a molecular weight of 299.30 g/mol. Its IUPAC name is N-(3,4-difluoro-2-hydroxyphenyl)-1-phenylmethanesulfonamide.
| Compound Name | N-(3,4-difluoro-2-hydroxyphenyl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 69009630 |
| Molecular Formula | C13H11F2NO3S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-(3,4-difluoro-2-hydroxyphenyl)-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)Nc1ccc(F)c(F)c1O |
| InChI | InChI=1S/C13H11F2NO3S/c14-10-6-7-11(13(17)12(10)15)16-20(18,19)8-9-4-2-1-3-5-9/h1-7,16-17H,8H2 |
| InChIKey | APTHTYCOZCWDRW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|