C24H25F2N3O3S — CID 11005226
2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide (PubChem CID 11005226) has the molecular formula C24H25F2N3O3S and a molecular weight of 473.55 g/mol. Its IUPAC name is 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide.
| Compound Name | 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 11005226 |
| Molecular Formula | C24H25F2N3O3S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
| SMILES | CN(C)c1ccc(CNC(=O)Cc2c(F)ccc(NS(=O)(=O)Cc3ccccc3)c2F)cc1 |
| InChI | InChI=1S/C24H25F2N3O3S/c1-29(2)19-10-8-17(9-11-19)15-27-23(30)14-20-21(25)12-13-22(24(20)26)28-33(31,32)16-18-6-4-3-5-7-18/h3-13,28H,14-16H2,1-2H3,(H,27,30) |
| InChIKey | VEKDJUKJLMGDLS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|