C23H24F2N4OS — CID 142085699
2-[3-(benzylsulfanylamino)-2,6-difluorophenyl]-N-[[3-(diaminomethyl)phenyl]methyl]acetamide (PubChem CID 142085699) has the molecular formula C23H24F2N4OS and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-[3-(benzylsulfanylamino)-2,6-difluorophenyl]-N-[[3-(diaminomethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[3-(benzylsulfanylamino)-2,6-difluorophenyl]-N-[[3-(diaminomethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 142085699 |
| Molecular Formula | C23H24F2N4OS |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-[3-(benzylsulfanylamino)-2,6-difluorophenyl]-N-[[3-(diaminomethyl)phenyl]methyl]acetamide |
| SMILES | NC(N)c1cccc(CNC(=O)Cc2c(F)ccc(NSCc3ccccc3)c2F)c1 |
| InChI | InChI=1S/C23H24F2N4OS/c24-19-9-10-20(29-31-14-15-5-2-1-3-6-15)22(25)18(19)12-21(30)28-13-16-7-4-8-17(11-16)23(26)27/h1-11,23,29H,12-14,26-27H2,(H,28,30) |
| InChIKey | NYZSNIYOOAZYRS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|