C10H12F2N2O — CID 175634041
2-amino-N-[[3-(difluoromethyl)phenyl]methyl]acetamide (PubChem CID 175634041) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-amino-N-[[3-(difluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-amino-N-[[3-(difluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 175634041 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-amino-N-[[3-(difluoromethyl)phenyl]methyl]acetamide |
| SMILES | NCC(=O)NCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C10H12F2N2O/c11-10(12)8-3-1-2-7(4-8)6-14-9(15)5-13/h1-4,10H,5-6,13H2,(H,14,15) |
| InChIKey | GWZVGCJLXIKRKN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |