C13H11F3N2O2S — CID 43256402
1-(3-aminophenyl)-N-(2,3,4-trifluorophenyl)methanesulfonamide (PubChem CID 43256402) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is 1-(3-aminophenyl)-N-(2,3,4-trifluorophenyl)methanesulfonamide.
| Compound Name | 1-(3-aminophenyl)-N-(2,3,4-trifluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 43256402 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-(3-aminophenyl)-N-(2,3,4-trifluorophenyl)methanesulfonamide |
| SMILES | Nc1cccc(CS(=O)(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C13H11F3N2O2S/c14-10-4-5-11(13(16)12(10)15)18-21(19,20)7-8-2-1-3-9(17)6-8/h1-6,18H,7,17H2 |
| InChIKey | RFXXFKYWRZKURT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|