C12H13N3O2S — CID 43255711
1-(3-aminophenyl)-N-pyridin-2-ylmethanesulfonamide (PubChem CID 43255711) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 1-(3-aminophenyl)-N-pyridin-2-ylmethanesulfonamide.
| Compound Name | 1-(3-aminophenyl)-N-pyridin-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 43255711 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-(3-aminophenyl)-N-pyridin-2-ylmethanesulfonamide |
| SMILES | Nc1cccc(CS(=O)(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C12H13N3O2S/c13-11-5-3-4-10(8-11)9-18(16,17)15-12-6-1-2-7-14-12/h1-8H,9,13H2,(H,14,15) |
| InChIKey | VNFUGVAFLFHIPW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|