C11H12N2O3S2 — CID 110730606
N-[(1-methyl-6-oxo-3-pyridinyl)methyl]thiophene-2-sulfonamide (PubChem CID 110730606) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[(1-methyl-6-oxo-3-pyridinyl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1-methyl-6-oxo-3-pyridinyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110730606 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | N-[(1-methyl-6-oxo-3-pyridinyl)methyl]thiophene-2-sulfonamide |
| SMILES | Cn1cc(CNS(=O)(=O)c2cccs2)ccc1=O |
| InChI | InChI=1S/C11H12N2O3S2/c1-13-8-9(4-5-10(13)14)7-12-18(15,16)11-3-2-6-17-11/h2-6,8,12H,7H2,1H3 |
| InChIKey | KQCVJFYLDDBXDZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |