C15H14N2O3S2 — CID 110666144
N-[(3-methyl-2-oxo-1H-quinolin-6-yl)methyl]thiophene-2-sulfonamide (PubChem CID 110666144) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(3-methyl-2-oxo-1H-quinolin-6-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(3-methyl-2-oxo-1H-quinolin-6-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110666144 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-[(3-methyl-2-oxo-1H-quinolin-6-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc2cc(CNS(=O)(=O)c3cccs3)ccc2[nH]c1=O |
| InChI | InChI=1S/C15H14N2O3S2/c1-10-7-12-8-11(4-5-13(12)17-15(10)18)9-16-22(19,20)14-3-2-6-21-14/h2-8,16H,9H2,1H3,(H,17,18) |
| InChIKey | MCHWIJVKLSIEIZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |