C14H14N2O3S2 — CID 110781511
N-[(1-methyl-2-oxo-3H-indol-5-yl)methyl]thiophene-2-sulfonamide (PubChem CID 110781511) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(1-methyl-2-oxo-3H-indol-5-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1-methyl-2-oxo-3H-indol-5-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110781511 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-[(1-methyl-2-oxo-3H-indol-5-yl)methyl]thiophene-2-sulfonamide |
| SMILES | CN1C(=O)Cc2cc(CNS(=O)(=O)c3cccs3)ccc21 |
| InChI | InChI=1S/C14H14N2O3S2/c1-16-12-5-4-10(7-11(12)8-13(16)17)9-15-21(18,19)14-3-2-6-20-14/h2-7,15H,8-9H2,1H3 |
| InChIKey | JMIQKXXBAZFGHO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |