C14H14N2O3S2 — CID 110730098
N-[2-(2-oxo-3H-indol-1-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110730098) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[2-(2-oxo-3H-indol-1-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(2-oxo-3H-indol-1-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110730098 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-[2-(2-oxo-3H-indol-1-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=C1Cc2ccccc2N1CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H14N2O3S2/c17-13-10-11-4-1-2-5-12(11)16(13)8-7-15-21(18,19)14-6-3-9-20-14/h1-6,9,15H,7-8,10H2 |
| InChIKey | RAQTXLJIXNMYDV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |