C18H16N4O3S — CID 110672337
1-methyl-2-oxo-N-(quinoxalin-6-ylmethyl)-3H-indole-5-sulfonamide (PubChem CID 110672337) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-(quinoxalin-6-ylmethyl)-3H-indole-5-sulfonamide.
| Compound Name | 1-methyl-2-oxo-N-(quinoxalin-6-ylmethyl)-3H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 110672337 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-methyl-2-oxo-N-(quinoxalin-6-ylmethyl)-3H-indole-5-sulfonamide |
| SMILES | CN1C(=O)Cc2cc(S(=O)(=O)NCc3ccc4nccnc4c3)ccc21 |
| InChI | InChI=1S/C18H16N4O3S/c1-22-17-5-3-14(9-13(17)10-18(22)23)26(24,25)21-11-12-2-4-15-16(8-12)20-7-6-19-15/h2-9,21H,10-11H2,1H3 |
| InChIKey | MXZCYHQZCGHLAK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |