C20H18N2O3S2 — CID 110292520
1-methyl-2-oxo-N-[(5-phenylthiophen-2-yl)methyl]-3H-indole-5-sulfonamide (PubChem CID 110292520) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-[(5-phenylthiophen-2-yl)methyl]-3H-indole-5-sulfonamide.
| Compound Name | 1-methyl-2-oxo-N-[(5-phenylthiophen-2-yl)methyl]-3H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 110292520 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1-methyl-2-oxo-N-[(5-phenylthiophen-2-yl)methyl]-3H-indole-5-sulfonamide |
| SMILES | CN1C(=O)Cc2cc(S(=O)(=O)NCc3ccc(-c4ccccc4)s3)ccc21 |
| InChI | InChI=1S/C20H18N2O3S2/c1-22-18-9-8-17(11-15(18)12-20(22)23)27(24,25)21-13-16-7-10-19(26-16)14-5-3-2-4-6-14/h2-11,21H,12-13H2,1H3 |
| InChIKey | UDGFPGIDRRBIRC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |