C18H17ClN2O3S — CID 110417935
2-chloro-N-[2-(3-methyl-2-oxo-1H-quinolin-6-yl)ethyl]benzenesulfonamide (PubChem CID 110417935) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is 2-chloro-N-[2-(3-methyl-2-oxo-1H-quinolin-6-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-(3-methyl-2-oxo-1H-quinolin-6-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110417935 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-chloro-N-[2-(3-methyl-2-oxo-1H-quinolin-6-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc2cc(CCNS(=O)(=O)c3ccccc3Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C18H17ClN2O3S/c1-12-10-14-11-13(6-7-16(14)21-18(12)22)8-9-20-25(23,24)17-5-3-2-4-15(17)19/h2-7,10-11,20H,8-9H2,1H3,(H,21,22) |
| InChIKey | GIZMUKYNUQSULM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |