C16H18ClNO2S — CID 3685302
2-chloro-N-[2-(2,4-dimethylphenyl)ethyl]benzenesulfonamide (PubChem CID 3685302) has the molecular formula C16H18ClNO2S and a molecular weight of 323.85 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,4-dimethylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-(2,4-dimethylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3685302 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-chloro-N-[2-(2,4-dimethylphenyl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(CCNS(=O)(=O)c2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C16H18ClNO2S/c1-12-7-8-14(13(2)11-12)9-10-18-21(19,20)16-6-4-3-5-15(16)17/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | DGSRBVXQOPNDCB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |