C24H21NO4S — CID 3787610
N-[2-(2,4-dimethylphenyl)ethyl]-9,10-dioxoanthracene-1-sulfonamide (PubChem CID 3787610) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenyl)ethyl]-9,10-dioxoanthracene-1-sulfonamide.
| Compound Name | N-[2-(2,4-dimethylphenyl)ethyl]-9,10-dioxoanthracene-1-sulfonamide |
|---|---|
| PubChem CID | 3787610 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[2-(2,4-dimethylphenyl)ethyl]-9,10-dioxoanthracene-1-sulfonamide |
| SMILES | Cc1ccc(CCNS(=O)(=O)c2cccc3c2C(=O)c2ccccc2C3=O)c(C)c1 |
| InChI | InChI=1S/C24H21NO4S/c1-15-10-11-17(16(2)14-15)12-13-25-30(28,29)21-9-5-8-20-22(21)24(27)19-7-4-3-6-18(19)23(20)26/h3-11,14,25H,12-13H2,1-2H3 |
| InChIKey | NGCXHKKXEMFCGN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|