C22H17NO5S — CID 3855904
9,10-dioxo-N-(2-phenoxyethyl)anthracene-1-sulfonamide (PubChem CID 3855904) has the molecular formula C22H17NO5S and a molecular weight of 407.45 g/mol. Its IUPAC name is 9,10-dioxo-N-(2-phenoxyethyl)anthracene-1-sulfonamide.
| Compound Name | 9,10-dioxo-N-(2-phenoxyethyl)anthracene-1-sulfonamide |
|---|---|
| PubChem CID | 3855904 |
| Molecular Formula | C22H17NO5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 9,10-dioxo-N-(2-phenoxyethyl)anthracene-1-sulfonamide |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2S(=O)(=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C22H17NO5S/c24-21-16-9-4-5-10-17(16)22(25)20-18(21)11-6-12-19(20)29(26,27)23-13-14-28-15-7-2-1-3-8-15/h1-12,23H,13-14H2 |
| InChIKey | YGBZQNNLEHBRQA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|