C20H19NO6S — CID 74227907
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-9,10-dioxoanthracene-1-sulfonamide (PubChem CID 74227907) has the molecular formula C20H19NO6S and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-9,10-dioxoanthracene-1-sulfonamide.
| Compound Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-9,10-dioxoanthracene-1-sulfonamide |
|---|---|
| PubChem CID | 74227907 |
| Molecular Formula | C20H19NO6S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-9,10-dioxoanthracene-1-sulfonamide |
| SMILES | CC1(C)OCC(CNS(=O)(=O)c2cccc3c2C(=O)c2ccccc2C3=O)O1 |
| InChI | InChI=1S/C20H19NO6S/c1-20(2)26-11-12(27-20)10-21-28(24,25)16-9-5-8-15-17(16)19(23)14-7-4-3-6-13(14)18(15)22/h3-9,12,21H,10-11H2,1-2H3 |
| InChIKey | QVAAYFMIMLNYPK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|