C14H15ClN2O3S — CID 110730618
1-(2-chlorophenyl)-N-[(1-methyl-6-oxo-3-pyridinyl)methyl]methanesulfonamide (PubChem CID 110730618) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[(1-methyl-6-oxo-3-pyridinyl)methyl]methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-[(1-methyl-6-oxo-3-pyridinyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 110730618 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[(1-methyl-6-oxo-3-pyridinyl)methyl]methanesulfonamide |
| SMILES | Cn1cc(CNS(=O)(=O)Cc2ccccc2Cl)ccc1=O |
| InChI | InChI=1S/C14H15ClN2O3S/c1-17-9-11(6-7-14(17)18)8-16-21(19,20)10-12-4-2-3-5-13(12)15/h2-7,9,16H,8,10H2,1H3 |
| InChIKey | FBLHDGGXLDWNKL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |