C15H14F3NO2S — CID 25046521
4-ethyl-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide (PubChem CID 25046521) has the molecular formula C15H14F3NO2S and a molecular weight of 329.34 g/mol. Its IUPAC name is 4-ethyl-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25046521 |
| Molecular Formula | C15H14F3NO2S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-ethyl-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCc2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H14F3NO2S/c1-2-10-3-5-12(6-4-10)22(20,21)19-9-11-7-13(16)15(18)14(17)8-11/h3-8,19H,2,9H2,1H3 |
| InChIKey | ISLCKCDASJCTKA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|