C15H13F4NO2S — CID 3770733
N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-4-methylbenzenesulfonamide (PubChem CID 3770733) has the molecular formula C15H13F4NO2S and a molecular weight of 347.33 g/mol. Its IUPAC name is N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3770733 |
| Molecular Formula | C15H13F4NO2S |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccc(C(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H13F4NO2S/c1-10-2-5-12(6-3-10)23(21,22)20-9-11-4-7-13(14(16)8-11)15(17,18)19/h2-8,20H,9H2,1H3 |
| InChIKey | CBTPFOWQKPQXOY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |