C11H15F4N — CID 142344458
ethane;1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylmethanamine (PubChem CID 142344458) has the molecular formula C11H15F4N and a molecular weight of 237.24 g/mol. Its IUPAC name is ethane;1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylmethanamine.
| Compound Name | ethane;1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 142344458 |
| Molecular Formula | C11H15F4N |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | ethane;1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylmethanamine |
| SMILES | CC.CNCc1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C9H9F4N.C2H6/c1-14-5-6-2-3-7(8(10)4-6)9(11,12)13;1-2/h2-4,14H,5H2,1H3;1-2H3 |
| InChIKey | NTLWVUUYDUFEOI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |