C16H23F4N3 — CID 143375714
N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-1-[2-(methylamino)ethyl]piperidin-4-amine (PubChem CID 143375714) has the molecular formula C16H23F4N3 and a molecular weight of 333.37 g/mol. Its IUPAC name is N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-1-[2-(methylamino)ethyl]piperidin-4-amine.
| Compound Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-1-[2-(methylamino)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 143375714 |
| Molecular Formula | C16H23F4N3 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-1-[2-(methylamino)ethyl]piperidin-4-amine |
| SMILES | CNCCN1CCC(NCc2ccc(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H23F4N3/c1-21-6-9-23-7-4-13(5-8-23)22-11-12-2-3-14(15(17)10-12)16(18,19)20/h2-3,10,13,21-22H,4-9,11H2,1H3 |
| InChIKey | KIAOZPJJGLGQJN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |