C12H8BrCl3N2O2S — CID 3838244
5-bromo-6-chloro-N-[(2,5-dichlorophenyl)methyl]pyridine-3-sulfonamide (PubChem CID 3838244) has the molecular formula C12H8BrCl3N2O2S and a molecular weight of 430.54 g/mol. Its IUPAC name is 5-bromo-6-chloro-N-[(2,5-dichlorophenyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-6-chloro-N-[(2,5-dichlorophenyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 3838244 |
| Molecular Formula | C12H8BrCl3N2O2S |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 427.86 |
| IUPAC Name | 5-bromo-6-chloro-N-[(2,5-dichlorophenyl)methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCc1cc(Cl)ccc1Cl)c1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H8BrCl3N2O2S/c13-10-4-9(6-17-12(10)16)21(19,20)18-5-7-3-8(14)1-2-11(7)15/h1-4,6,18H,5H2 |
| InChIKey | LGUJHMNVRIEGAO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|