C10H7BrClN3O2S — CID 4729992
5-bromo-6-chloro-N-pyridin-4-ylpyridine-3-sulfonamide (PubChem CID 4729992) has the molecular formula C10H7BrClN3O2S and a molecular weight of 348.61 g/mol. Its IUPAC name is 5-bromo-6-chloro-N-pyridin-4-ylpyridine-3-sulfonamide.
| Compound Name | 5-bromo-6-chloro-N-pyridin-4-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 4729992 |
| Molecular Formula | C10H7BrClN3O2S |
| Molecular Weight | 348.61 g/mol |
| Exact Mass | 346.91 |
| IUPAC Name | 5-bromo-6-chloro-N-pyridin-4-ylpyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccncc1)c1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C10H7BrClN3O2S/c11-9-5-8(6-14-10(9)12)18(16,17)15-7-1-3-13-4-2-7/h1-6H,(H,13,15) |
| InChIKey | FVAWBHZDWDSZGX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|