C22H14Br2Cl2N4O6S3 — CID 4730144
5-bromo-N-[4-[4-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]phenyl]sulfonylphenyl]-6-chloropyridine-3-sulfonamide (PubChem CID 4730144) has the molecular formula C22H14Br2Cl2N4O6S3 and a molecular weight of 757.29 g/mol. Its IUPAC name is 5-bromo-N-[4-[4-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]phenyl]sulfonylphenyl]-6-chloropyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-[4-[4-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]phenyl]sulfonylphenyl]-6-chloropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 4730144 |
| Molecular Formula | C22H14Br2Cl2N4O6S3 |
| Molecular Weight | 757.29 g/mol |
| Exact Mass | 753.78 |
| IUPAC Name | 5-bromo-N-[4-[4-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]phenyl]sulfonylphenyl]-6-chloropyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)c2ccc(NS(=O)(=O)c3cnc(Cl)c(Br)c3)cc2)cc1)c1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C22H14Br2Cl2N4O6S3/c23-19-9-17(11-27-21(19)25)38(33,34)29-13-1-5-15(6-2-13)37(31,32)16-7-3-14(4-8-16)30-39(35,36)18-10-20(24)22(26)28-12-18/h1-12,29-30H |
| InChIKey | HVFMMDMUHBFLFA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.29 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|