C11H9BrClN3O2S — CID 106606554
N-(6-amino-3-pyridinyl)-3-bromo-4-chlorobenzenesulfonamide (PubChem CID 106606554) has the molecular formula C11H9BrClN3O2S and a molecular weight of 362.64 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-3-bromo-4-chlorobenzenesulfonamide.
| Compound Name | N-(6-amino-3-pyridinyl)-3-bromo-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 106606554 |
| Molecular Formula | C11H9BrClN3O2S |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-3-bromo-4-chlorobenzenesulfonamide |
| SMILES | Nc1ccc(NS(=O)(=O)c2ccc(Cl)c(Br)c2)cn1 |
| InChI | InChI=1S/C11H9BrClN3O2S/c12-9-5-8(2-3-10(9)13)19(17,18)16-7-1-4-11(14)15-6-7/h1-6,16H,(H2,14,15) |
| InChIKey | VLZMYXUCCSAOLI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |