C13H13N3O4S — CID 60791769
N-(6-amino-3-pyridinyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 60791769) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(6-amino-3-pyridinyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 60791769 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | Nc1ccc(NS(=O)(=O)c2ccc3c(c2)OCCO3)cn1 |
| InChI | InChI=1S/C13H13N3O4S/c14-13-4-1-9(8-15-13)16-21(17,18)10-2-3-11-12(7-10)20-6-5-19-11/h1-4,7-8,16H,5-6H2,(H2,14,15) |
| InChIKey | HAIYKPRWWCGAJQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |